C9H16FNO2 — CID 118197680
(6R,7R,8S)-8-(2-fluoroethyl)-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 118197680) has the molecular formula C9H16FNO2 and a molecular weight of 189.23 g/mol. Its IUPAC name is (6R,7R,8S)-8-(2-fluoroethyl)-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-(2-fluoroethyl)-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 118197680 |
| Molecular Formula | C9H16FNO2 |
| Molecular Weight | 189.23 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | (6R,7R,8S)-8-(2-fluoroethyl)-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | O[C@H]1[C@H](O)CNC2(CC2)[C@@H]1CCF |
| InChI | InChI=1S/C9H16FNO2/c10-4-1-6-8(13)7(12)5-11-9(6)2-3-9/h6-8,11-13H,1-5H2/t6-,7-,8-/m1/s1 |
| InChIKey | MVUMUMOZSPIRQJ-BWZBUEFSSA-N |
| XLogP | -0.18 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |