About 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide
4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide (PubChem CID 118197886) has the molecular formula C21H16F2N4O3
and a molecular weight of 410.38 g/mol. Its IUPAC name is 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide.
Molecular Properties
| Compound Name | 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide |
| PubChem CID | 118197886 |
| Molecular Formula | C21H16F2N4O3 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide |
| SMILES | NC(=O)c1ccc(F)cc1.NC(=O)c1ccc(Oc2cccn3nccc23)c(F)c1 |
| InChI | InChI=1S/C14H10FN3O2.C7H6FNO/c15-10-8-9(14(16)19)3-4-12(10)20-13-2-1-7-18-11(13)5-6-17-18;8-6-3-1-5(2-4-6)7(9)10/h1-8H,(H2,16,19);1-4H,(H2,9,10) |
| InChIKey | HFEMLDKWHZZKPL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide?
The IUPAC name of 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide (CID 118197886) is 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide.
What is the SMILES notation for 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide?
The canonical SMILES for 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide is NC(=O)c1ccc(F)cc1.NC(=O)c1ccc(Oc2cccn3nccc23)c(F)c1.
What is the InChIKey of 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide?
The InChIKey is HFEMLDKWHZZKPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10FN3O2.C7H6FNO/c15-10-8-9(14(16)19)3-4-12(10)20-13-2-1-7-18-11(13)5-6-17-18;8-6-3-1-5(2-4-6)7(9)10/h1-8H,(H2,16,19);1-4H,(H2,9,10).
What are the key properties of 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide?
4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide has a molecular weight of 410.38 g/mol, XLogP of 3.29, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzamide;3-fluoro-4-pyrazolo[1,5-a]pyridin-4-yloxybenzamide is sourced from PubChem (CID 118197886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).