C22H19F4NO3S — CID 118198362
3-[4-[[3-(4-ethylphenyl)-5-(fluoromethyl)-1,2-thiazol-4-yl]methoxy]-2,3,5-trifluorophenyl]propanoic acid (PubChem CID 118198362) has the molecular formula C22H19F4NO3S and a molecular weight of 453.46 g/mol. Its IUPAC name is 3-[4-[[3-(4-ethylphenyl)-5-(fluoromethyl)-1,2-thiazol-4-yl]methoxy]-2,3,5-trifluorophenyl]propanoic acid.
| Compound Name | 3-[4-[[3-(4-ethylphenyl)-5-(fluoromethyl)-1,2-thiazol-4-yl]methoxy]-2,3,5-trifluorophenyl]propanoic acid |
|---|---|
| PubChem CID | 118198362 |
| Molecular Formula | C22H19F4NO3S |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 3-[4-[[3-(4-ethylphenyl)-5-(fluoromethyl)-1,2-thiazol-4-yl]methoxy]-2,3,5-trifluorophenyl]propanoic acid |
| SMILES | CCc1ccc(-c2nsc(CF)c2COc2c(F)cc(CCC(=O)O)c(F)c2F)cc1 |
| InChI | InChI=1S/C22H19F4NO3S/c1-2-12-3-5-13(6-4-12)21-15(17(10-23)31-27-21)11-30-22-16(24)9-14(7-8-18(28)29)19(25)20(22)26/h3-6,9H,2,7-8,10-11H2,1H3,(H,28,29) |
| InChIKey | FPVBNDKAQFZXNE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|