About diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate
diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate (PubChem CID 118198503) has the molecular formula C18H25N3O4
and a molecular weight of 347.42 g/mol. Its IUPAC name is diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate.
Molecular Properties
| Compound Name | diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate |
| PubChem CID | 118198503 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)n1ncc2c1C=CC1(CCNCC1)C2 |
| InChI | InChI=1S/C18H25N3O4/c1-3-24-16(22)15(17(23)25-4-2)21-14-5-6-18(7-9-19-10-8-18)11-13(14)12-20-21/h5-6,12,15,19H,3-4,7-11H2,1-2H3 |
| InChIKey | JTMGTDCDULXAQD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate?
The IUPAC name of diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate (CID 118198503) is diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate.
What is the SMILES notation for diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate?
The canonical SMILES for diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate is CCOC(=O)C(C(=O)OCC)n1ncc2c1C=CC1(CCNCC1)C2.
What is the InChIKey of diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate?
The InChIKey is JTMGTDCDULXAQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N3O4/c1-3-24-16(22)15(17(23)25-4-2)21-14-5-6-18(7-9-19-10-8-18)11-13(14)12-20-21/h5-6,12,15,19H,3-4,7-11H2,1-2H3.
What are the key properties of diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate?
diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate has a molecular weight of 347.42 g/mol, XLogP of 1.49, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-spiro[4H-indazole-5,4'-piperidine]-1-ylpropanedioate is sourced from PubChem (CID 118198503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).