C33H66N2 — CID 118198658
6-[12-(dimethylamino)-14-ethyl-2,3,13,13,15-pentamethyloctadecan-2-yl]cyclohex-2-en-1-amine (PubChem CID 118198658) has the molecular formula C33H66N2 and a molecular weight of 490.91 g/mol. Its IUPAC name is 6-[12-(dimethylamino)-14-ethyl-2,3,13,13,15-pentamethyloctadecan-2-yl]cyclohex-2-en-1-amine.
| Compound Name | 6-[12-(dimethylamino)-14-ethyl-2,3,13,13,15-pentamethyloctadecan-2-yl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 118198658 |
| Molecular Formula | C33H66N2 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.52 |
| IUPAC Name | 6-[12-(dimethylamino)-14-ethyl-2,3,13,13,15-pentamethyloctadecan-2-yl]cyclohex-2-en-1-amine |
| SMILES | CCCC(C)C(CC)C(C)(C)C(CCCCCCCCC(C)C(C)(C)C1CCC=CC1N)N(C)C |
| InChI | InChI=1S/C33H66N2/c1-11-21-26(3)28(12-2)33(7,8)31(35(9)10)25-18-16-14-13-15-17-22-27(4)32(5,6)29-23-19-20-24-30(29)34/h20,24,26-31H,11-19,21-23,25,34H2,1-10H3 |
| InChIKey | VOXZZDSLYUNXDB-UHFFFAOYSA-N |
| XLogP | 9.48 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|