About 3-amino-4-benzyl-1,2,4-oxadiazol-5-one
3-amino-4-benzyl-1,2,4-oxadiazol-5-one (PubChem CID 11819868) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 3-amino-4-benzyl-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-amino-4-benzyl-1,2,4-oxadiazol-5-one |
| PubChem CID | 11819868 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 3-amino-4-benzyl-1,2,4-oxadiazol-5-one |
| SMILES | Nc1noc(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C9H9N3O2/c10-8-11-14-9(13)12(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11) |
| InChIKey | INGXGQDQJRFVBB-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 74.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-4-benzyl-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-benzyl-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-amino-4-benzyl-1,2,4-oxadiazol-5-one (CID 11819868) is 3-amino-4-benzyl-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-amino-4-benzyl-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-amino-4-benzyl-1,2,4-oxadiazol-5-one is Nc1noc(=O)n1Cc1ccccc1.
What is the InChIKey of 3-amino-4-benzyl-1,2,4-oxadiazol-5-one?
The InChIKey is INGXGQDQJRFVBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c10-8-11-14-9(13)12(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11).
What are the key properties of 3-amino-4-benzyl-1,2,4-oxadiazol-5-one?
3-amino-4-benzyl-1,2,4-oxadiazol-5-one has a molecular weight of 191.19 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-benzyl-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 11819868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).