About 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate
4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate (PubChem CID 118198749) has the molecular formula C14H21NO2
and a molecular weight of 235.33 g/mol. Its IUPAC name is 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate.
Molecular Properties
| Compound Name | 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate |
| PubChem CID | 118198749 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate |
| SMILES | NC=CC(=O)OCC1CC2C3CCC(C3)C2C1 |
| InChI | InChI=1S/C14H21NO2/c15-4-3-14(16)17-8-9-5-12-10-1-2-11(7-10)13(12)6-9/h3-4,9-13H,1-2,5-8,15H2 |
| InChIKey | GAZWNVOUKCTIHE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate?
The IUPAC name of 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate (CID 118198749) is 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate.
What is the SMILES notation for 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate?
The canonical SMILES for 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate is NC=CC(=O)OCC1CC2C3CCC(C3)C2C1.
What is the InChIKey of 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate?
The InChIKey is GAZWNVOUKCTIHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO2/c15-4-3-14(16)17-8-9-5-12-10-1-2-11(7-10)13(12)6-9/h3-4,9-13H,1-2,5-8,15H2.
What are the key properties of 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate?
4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate has a molecular weight of 235.33 g/mol, XLogP of 2.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tricyclo[5.2.1.02,6]decanylmethyl 3-aminoprop-2-enoate is sourced from PubChem (CID 118198749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).