About 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine
3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine (PubChem CID 118198827) has the molecular formula C13H23NS
and a molecular weight of 225.40 g/mol. Its IUPAC name is 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine |
| PubChem CID | 118198827 |
| Molecular Formula | C13H23NS |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine |
| SMILES | C=C(S/C=C\C)C(=C)N(CCC)CCC |
| InChI | InChI=1S/C13H23NS/c1-6-9-14(10-7-2)12(4)13(5)15-11-8-3/h8,11H,4-7,9-10H2,1-3H3/b11-8- |
| InChIKey | LUKOPATZWBNFFK-FLIBITNWSA-N |
| XLogP | 4.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine?
The IUPAC name of 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine (CID 118198827) is 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine.
What is the SMILES notation for 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine?
The canonical SMILES for 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine is C=C(S/C=C\C)C(=C)N(CCC)CCC.
What is the InChIKey of 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine?
The InChIKey is LUKOPATZWBNFFK-FLIBITNWSA-N. The full InChI is InChI=1S/C13H23NS/c1-6-9-14(10-7-2)12(4)13(5)15-11-8-3/h8,11H,4-7,9-10H2,1-3H3/b11-8-.
What are the key properties of 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine?
3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine has a molecular weight of 225.40 g/mol, XLogP of 4.40, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-prop-1-enyl]sulfanyl-N,N-dipropylbuta-1,3-dien-2-amine is sourced from PubChem (CID 118198827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).