C20H19F19O2 — CID 118198835
1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene (PubChem CID 118198835) has the molecular formula C20H19F19O2 and a molecular weight of 652.33 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
|---|---|
| PubChem CID | 118198835 |
| Molecular Formula | C20H19F19O2 |
| Molecular Weight | 652.33 g/mol |
| Exact Mass | 652.11 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[4,5,5,5-tetrafluoro-4-methyl-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
| SMILES | CC(OCCOC(=C(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F)C(F)(F)F)=C(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C20H19F19O2/c1-8(9(12(2,21)17(28,29)30)13(3,22)18(31,32)33)40-6-7-41-11(16(25,26)27)10(14(4,23)19(34,35)36)15(5,24)20(37,38)39/h6-7H2,1-5H3 |
| InChIKey | PNIBCROJDFLUPD-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.33 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|