C20H22F16O2 — CID 118198838
1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[(Z)-4,5,5,5-tetrafluoro-3-(2-fluoropropan-2-yl)-4-methylpent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene (PubChem CID 118198838) has the molecular formula C20H22F16O2 and a molecular weight of 598.36 g/mol. Its IUPAC name is 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[(Z)-4,5,5,5-tetrafluoro-3-(2-fluoropropan-2-yl)-4-methylpent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene.
| Compound Name | 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[(Z)-4,5,5,5-tetrafluoro-3-(2-fluoropropan-2-yl)-4-methylpent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
|---|---|
| PubChem CID | 118198838 |
| Molecular Formula | C20H22F16O2 |
| Molecular Weight | 598.36 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 1,1,1,4,5,5,5-heptafluoro-4-methyl-2-[2-[(Z)-4,5,5,5-tetrafluoro-3-(2-fluoropropan-2-yl)-4-methylpent-2-en-2-yl]oxyethoxy]-3-(1,1,1,2-tetrafluoropropan-2-yl)pent-2-ene |
| SMILES | C/C(OCCOC(=C(C(C)(F)C(F)(F)F)C(C)(F)C(F)(F)F)C(F)(F)F)=C(\C(C)(C)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C20H22F16O2/c1-9(10(13(2,3)21)14(4,22)18(28,29)30)37-7-8-38-12(17(25,26)27)11(15(5,23)19(31,32)33)16(6,24)20(34,35)36/h7-8H2,1-6H3/b10-9-,12-11? |
| InChIKey | FHQNEVKZUVHVIC-JMZFJITMSA-N |
| XLogP | 8.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.36 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|