C21H21N3O7 — CID 118199020
6-[2-(2-hydroxyethoxy)ethyl]-13-(2-hydroxypropylamino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 118199020) has the molecular formula C21H21N3O7 and a molecular weight of 427.41 g/mol. Its IUPAC name is 6-[2-(2-hydroxyethoxy)ethyl]-13-(2-hydroxypropylamino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-[2-(2-hydroxyethoxy)ethyl]-13-(2-hydroxypropylamino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 118199020 |
| Molecular Formula | C21H21N3O7 |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 6-[2-(2-hydroxyethoxy)ethyl]-13-(2-hydroxypropylamino)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CC(O)CNN1C(=O)c2ccc3c4c(ccc(c24)C1=O)C(=O)N(CCOCCO)C3=O |
| InChI | InChI=1S/C21H21N3O7/c1-11(26)10-22-24-20(29)14-4-2-12-16-13(3-5-15(17(14)16)21(24)30)19(28)23(18(12)27)6-8-31-9-7-25/h2-5,11,22,25-26H,6-10H2,1H3 |
| InChIKey | FGLIYVMSRGTLSN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 136.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|