C11H15F2NO2 — CID 118199315
(6R,7R,8S)-8-(4,4-difluorobut-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 118199315) has the molecular formula C11H15F2NO2 and a molecular weight of 231.24 g/mol. Its IUPAC name is (6R,7R,8S)-8-(4,4-difluorobut-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-(4,4-difluorobut-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 118199315 |
| Molecular Formula | C11H15F2NO2 |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (6R,7R,8S)-8-(4,4-difluorobut-1-ynyl)-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | O[C@@H]1CNC2(CC2)C(C#CCC(F)F)[C@H]1O |
| InChI | InChI=1S/C11H15F2NO2/c12-9(13)3-1-2-7-10(16)8(15)6-14-11(7)4-5-11/h7-10,14-16H,3-6H2/t7?,8-,10-/m1/s1 |
| InChIKey | NCVMRSPXAUZSMD-JDOFKEMOSA-N |
| XLogP | 0.12 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|