C17H27NO5 — CID 118199323
tert-butyl (4aR,8aS)-2,2,3-trimethyl-8-oxospiro[3,4a,5,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate (PubChem CID 118199323) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is tert-butyl (4aR,8aS)-2,2,3-trimethyl-8-oxospiro[3,4a,5,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate.
| Compound Name | tert-butyl (4aR,8aS)-2,2,3-trimethyl-8-oxospiro[3,4a,5,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
|---|---|
| PubChem CID | 118199323 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | tert-butyl (4aR,8aS)-2,2,3-trimethyl-8-oxospiro[3,4a,5,8a-tetrahydro-[1,4]dioxino[2,3-c]pyridine-7,1'-cyclopropane]-6-carboxylate |
| SMILES | CC1O[C@@H]2CN(C(=O)OC(C)(C)C)C3(CC3)C(=O)[C@H]2OC1(C)C |
| InChI | InChI=1S/C17H27NO5/c1-10-16(5,6)22-12-11(21-10)9-18(14(20)23-15(2,3)4)17(7-8-17)13(12)19/h10-12H,7-9H2,1-6H3/t10?,11-,12+/m1/s1 |
| InChIKey | ZTPBQXGPCOOBID-SAIIYOCFSA-N |
| XLogP | 2.29 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |