C18H34O3 — CID 118199330
(3S,7S,8S,9S)-3,9-dimethyl-8-(3-methylbutyl)-7-propoxyoxonan-2-one (PubChem CID 118199330) has the molecular formula C18H34O3 and a molecular weight of 298.47 g/mol. Its IUPAC name is (3S,7S,8S,9S)-3,9-dimethyl-8-(3-methylbutyl)-7-propoxyoxonan-2-one.
| Compound Name | (3S,7S,8S,9S)-3,9-dimethyl-8-(3-methylbutyl)-7-propoxyoxonan-2-one |
|---|---|
| PubChem CID | 118199330 |
| Molecular Formula | C18H34O3 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.25 |
| IUPAC Name | (3S,7S,8S,9S)-3,9-dimethyl-8-(3-methylbutyl)-7-propoxyoxonan-2-one |
| SMILES | CCCO[C@H]1CCC[C@H](C)C(=O)O[C@@H](C)[C@@H]1CCC(C)C |
| InChI | InChI=1S/C18H34O3/c1-6-12-20-17-9-7-8-14(4)18(19)21-15(5)16(17)11-10-13(2)3/h13-17H,6-12H2,1-5H3/t14-,15-,16-,17-/m0/s1 |
| InChIKey | LLVZAQNMOZJSAQ-QAETUUGQSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |