C7H6N4OS — CID 11819943
2-sulfanylidene-3,4-dihydro-1H-pyrido[2,3-e][1,2,4]triazepin-5-one (PubChem CID 11819943) has the molecular formula C7H6N4OS and a molecular weight of 194.22 g/mol. Its IUPAC name is 2-sulfanylidene-3,4-dihydro-1H-pyrido[2,3-e][1,2,4]triazepin-5-one.
| Compound Name | 2-sulfanylidene-3,4-dihydro-1H-pyrido[2,3-e][1,2,4]triazepin-5-one |
|---|---|
| PubChem CID | 11819943 |
| Molecular Formula | C7H6N4OS |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 2-sulfanylidene-3,4-dihydro-1H-pyrido[2,3-e][1,2,4]triazepin-5-one |
| SMILES | O=C1NNC(=S)Nc2ncccc21 |
| InChI | InChI=1S/C7H6N4OS/c12-6-4-2-1-3-8-5(4)9-7(13)11-10-6/h1-3H,(H,10,12)(H2,8,9,11,13) |
| InChIKey | AIOZRJDQAXVFNK-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|