C10H17NO2 — CID 118199716
(6R,7R,8S)-8-[(Z)-prop-1-enyl]-4-azaspiro[2.5]octane-6,7-diol (PubChem CID 118199716) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (6R,7R,8S)-8-[(Z)-prop-1-enyl]-4-azaspiro[2.5]octane-6,7-diol.
| Compound Name | (6R,7R,8S)-8-[(Z)-prop-1-enyl]-4-azaspiro[2.5]octane-6,7-diol |
|---|---|
| PubChem CID | 118199716 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (6R,7R,8S)-8-[(Z)-prop-1-enyl]-4-azaspiro[2.5]octane-6,7-diol |
| SMILES | C/C=C\[C@@H]1[C@@H](O)[C@H](O)CNC12CC2 |
| InChI | InChI=1S/C10H17NO2/c1-2-3-7-9(13)8(12)6-11-10(7)4-5-10/h2-3,7-9,11-13H,4-6H2,1H3/b3-2-/t7-,8-,9-/m1/s1 |
| InChIKey | FFSYGJOLXBVJFU-VWAQZPJRSA-N |
| XLogP | 0.04 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|