C25H22ClN7 — CID 118200130
4-[11-[(4-chlorophenyl)methyl]-2,9,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 118200130) has the molecular formula C25H22ClN7 and a molecular weight of 455.95 g/mol. Its IUPAC name is 4-[11-[(4-chlorophenyl)methyl]-2,9,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-[11-[(4-chlorophenyl)methyl]-2,9,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 118200130 |
| Molecular Formula | C25H22ClN7 |
| Molecular Weight | 455.95 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 4-[11-[(4-chlorophenyl)methyl]-2,9,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,5,7-tetraen-6-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | Cn1nccc1Nc1cc(-c2cc3n4c(ncc4c2)C(Cc2ccc(Cl)cc2)CN3)ccn1 |
| InChI | InChI=1S/C25H22ClN7/c1-32-23(7-9-30-32)31-22-12-17(6-8-27-22)18-11-21-15-29-25-19(14-28-24(13-18)33(21)25)10-16-2-4-20(26)5-3-16/h2-9,11-13,15,19,28H,10,14H2,1H3,(H,27,31) |
| InChIKey | NPEILFMOKRCSEO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.95 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |