C24H20FN7O — CID 118200131
4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine (PubChem CID 118200131) has the molecular formula C24H20FN7O and a molecular weight of 441.47 g/mol. Its IUPAC name is 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine.
| Compound Name | 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 118200131 |
| Molecular Formula | C24H20FN7O |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 4-[5-[(4-fluorophenyl)methyl]-7-oxa-2,3,12-triazatricyclo[6.3.1.04,12]dodeca-1,3,8,10-tetraen-10-yl]-N-(2-methylpyrazol-3-yl)pyridin-2-amine |
| SMILES | Cn1nccc1Nc1cc(-c2cc3n4c(nnc4c2)C(Cc2ccc(F)cc2)CO3)ccn1 |
| InChI | InChI=1S/C24H20FN7O/c1-31-21(7-9-27-31)28-20-11-16(6-8-26-20)17-12-22-29-30-24-18(14-33-23(13-17)32(22)24)10-15-2-4-19(25)5-3-15/h2-9,11-13,18H,10,14H2,1H3,(H,26,28) |
| InChIKey | FYHHFBBAMDCCBP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |