C10H16N2S — CID 11820020
6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 11820020) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | 6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 11820020 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 6-propyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | CCCC1CCc2nc(N)sc2C1 |
| InChI | InChI=1S/C10H16N2S/c1-2-3-7-4-5-8-9(6-7)13-10(11)12-8/h7H,2-6H2,1H3,(H2,11,12) |
| InChIKey | JBMJUFXLQKSCQL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |