C22H40O3 — CID 118200313
[1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-3,3-dimethylbutyl] 2,2-dimethylbutanoate (PubChem CID 118200313) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-3,3-dimethylbutyl] 2,2-dimethylbutanoate.
| Compound Name | [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-3,3-dimethylbutyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118200313 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | [1-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-2-yloxy)-3,3-dimethylbutyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(CC(C)(C)C)OC1CCC2CCCCC2C1 |
| InChI | InChI=1S/C22H40O3/c1-7-22(5,6)20(23)25-19(15-21(2,3)4)24-18-13-12-16-10-8-9-11-17(16)14-18/h16-19H,7-15H2,1-6H3 |
| InChIKey | GVGHVTFBGZFXLW-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|