About 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine
3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (PubChem CID 118200555) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
Molecular Properties
| Compound Name | 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine |
| PubChem CID | 118200555 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine |
| SMILES | C=Cc1ccc2c(c1)CC2NC |
| InChI | InChI=1S/C11H13N/c1-3-8-4-5-10-9(6-8)7-11(10)12-2/h3-6,11-12H,1,7H2,2H3 |
| InChIKey | MVPBJIBDZSJHIL-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The IUPAC name of 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine (CID 118200555) is 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine.
What is the SMILES notation for 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The canonical SMILES for 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is C=Cc1ccc2c(c1)CC2NC.
What is the InChIKey of 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
The InChIKey is MVPBJIBDZSJHIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-3-8-4-5-10-9(6-8)7-11(10)12-2/h3-6,11-12H,1,7H2,2H3.
What are the key properties of 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine?
3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine has a molecular weight of 159.23 g/mol, XLogP of 2.15, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-N-methylbicyclo[4.2.0]octa-1(6),2,4-trien-7-amine is sourced from PubChem (CID 118200555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).