About (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate
(2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate (PubChem CID 118201301) has the molecular formula C14H5Br2Cl3N2O2
and a molecular weight of 499.37 g/mol. Its IUPAC name is (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate.
Molecular Properties
| Compound Name | (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate |
| PubChem CID | 118201301 |
| Molecular Formula | C14H5Br2Cl3N2O2 |
| Molecular Weight | 499.37 g/mol |
| Exact Mass | 495.78 |
| IUPAC Name | (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate |
| SMILES | O=C(Oc1c(Br)cc(Br)c2nc3ccccc3nc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H5Br2Cl3N2O2/c15-6-5-7(16)12(23-13(22)14(17,18)19)11-10(6)20-8-3-1-2-4-9(8)21-11/h1-5H |
| InChIKey | LWMWOISAKUMTTQ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.37 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate?
The IUPAC name of (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate (CID 118201301) is (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate.
What is the SMILES notation for (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate?
The canonical SMILES for (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate is O=C(Oc1c(Br)cc(Br)c2nc3ccccc3nc12)C(Cl)(Cl)Cl.
What is the InChIKey of (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate?
The InChIKey is LWMWOISAKUMTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Br2Cl3N2O2/c15-6-5-7(16)12(23-13(22)14(17,18)19)11-10(6)20-8-3-1-2-4-9(8)21-11/h1-5H.
What are the key properties of (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate?
(2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate has a molecular weight of 499.37 g/mol, XLogP of 5.58, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dibromophenazin-1-yl) 2,2,2-trichloroacetate is sourced from PubChem (CID 118201301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).