About 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one
5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one (PubChem CID 11820150) has the molecular formula C8H5F3N2O
and a molecular weight of 202.13 g/mol. Its IUPAC name is 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 11820150 |
| Molecular Formula | C8H5F3N2O |
| Molecular Weight | 202.13 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one |
| SMILES | O=c1[nH]c2ccc(C(F)(F)F)cc2[nH]1 |
| InChI | InChI=1S/C8H5F3N2O/c9-8(10,11)4-1-2-5-6(3-4)13-7(14)12-5/h1-3H,(H2,12,13,14) |
| InChIKey | LSOWBXYANGMSPY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.13 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one (CID 11820150) is 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one is O=c1[nH]c2ccc(C(F)(F)F)cc2[nH]1.
What is the InChIKey of 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one?
The InChIKey is LSOWBXYANGMSPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F3N2O/c9-8(10,11)4-1-2-5-6(3-4)13-7(14)12-5/h1-3H,(H2,12,13,14).
What are the key properties of 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one?
5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one has a molecular weight of 202.13 g/mol, XLogP of 1.88, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 11820150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).