C20H20O6 — CID 118202396
(2E,5E,8E,11E,14E)-2-[(4-ethenylphenyl)methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadeca-2,5,8,11,14-pentaene (PubChem CID 118202396) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2E,5E,8E,11E,14E)-2-[(4-ethenylphenyl)methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadeca-2,5,8,11,14-pentaene.
| Compound Name | (2E,5E,8E,11E,14E)-2-[(4-ethenylphenyl)methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadeca-2,5,8,11,14-pentaene |
|---|---|
| PubChem CID | 118202396 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2E,5E,8E,11E,14E)-2-[(4-ethenylphenyl)methoxymethyl]-1,4,7,10,13-pentaoxacyclopentadeca-2,5,8,11,14-pentaene |
| SMILES | C=Cc1ccc(COC/C2=C\O/C=C/O/C=C/O/C=C/O/C=C/O2)cc1 |
| InChI | InChI=1S/C20H20O6/c1-2-18-3-5-19(6-4-18)15-25-17-20-16-24-12-11-22-8-7-21-9-10-23-13-14-26-20/h2-14,16H,1,15,17H2/b8-7+,10-9+,12-11+,14-13+,20-16+ |
| InChIKey | YSOZIIHOKDMWCF-JAERHHKNSA-N |
| XLogP | 4.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |