C24H24ClF3N4O2 — CID 118202592
N-[(2-chloro-4-pyridinyl)methyl]-1'-(2,2,2-trifluoroacetyl)spiro[2,5,6,7-tetrahydrocyclopenta[f]indole-3,4'-piperidine]-1-carboxamide (PubChem CID 118202592) has the molecular formula C24H24ClF3N4O2 and a molecular weight of 492.93 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)methyl]-1'-(2,2,2-trifluoroacetyl)spiro[2,5,6,7-tetrahydrocyclopenta[f]indole-3,4'-piperidine]-1-carboxamide.
| Compound Name | N-[(2-chloro-4-pyridinyl)methyl]-1'-(2,2,2-trifluoroacetyl)spiro[2,5,6,7-tetrahydrocyclopenta[f]indole-3,4'-piperidine]-1-carboxamide |
|---|---|
| PubChem CID | 118202592 |
| Molecular Formula | C24H24ClF3N4O2 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)methyl]-1'-(2,2,2-trifluoroacetyl)spiro[2,5,6,7-tetrahydrocyclopenta[f]indole-3,4'-piperidine]-1-carboxamide |
| SMILES | O=C(NCc1ccnc(Cl)c1)N1CC2(CCN(C(=O)C(F)(F)F)CC2)c2cc3c(cc21)CCC3 |
| InChI | InChI=1S/C24H24ClF3N4O2/c25-20-10-15(4-7-29-20)13-30-22(34)32-14-23(5-8-31(9-6-23)21(33)24(26,27)28)18-11-16-2-1-3-17(16)12-19(18)32/h4,7,10-12H,1-3,5-6,8-9,13-14H2,(H,30,34) |
| InChIKey | LCIRPWXZMFITSZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|