C20H28BrN — CID 118202701
(3Z,7E,10Z)-2-bromo-N-[(1E)-buta-1,3-dienyl]-8,9-dimethyltetradeca-1,3,7,10-tetraen-6-imine (PubChem CID 118202701) has the molecular formula C20H28BrN and a molecular weight of 362.36 g/mol. Its IUPAC name is (3Z,7E,10Z)-2-bromo-N-[(1E)-buta-1,3-dienyl]-8,9-dimethyltetradeca-1,3,7,10-tetraen-6-imine.
| Compound Name | (3Z,7E,10Z)-2-bromo-N-[(1E)-buta-1,3-dienyl]-8,9-dimethyltetradeca-1,3,7,10-tetraen-6-imine |
|---|---|
| PubChem CID | 118202701 |
| Molecular Formula | C20H28BrN |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | (3Z,7E,10Z)-2-bromo-N-[(1E)-buta-1,3-dienyl]-8,9-dimethyltetradeca-1,3,7,10-tetraen-6-imine |
| SMILES | C=C/C=C/N=C(/C=C(\C)C(C)/C=C\CCC)C/C=C\C(=C)Br |
| InChI | InChI=1S/C20H28BrN/c1-6-8-10-12-17(3)18(4)16-20(22-15-9-7-2)14-11-13-19(5)21/h7,9-13,15-17H,2,5-6,8,14H2,1,3-4H3/b12-10-,13-11-,15-9+,18-16+,22-20+ |
| InChIKey | HHHTYTBYXROTDM-NVOYBSRCSA-N |
| XLogP | 6.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|