About (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol
(1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol (PubChem CID 118203027) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol.
Molecular Properties
| Compound Name | (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol |
| PubChem CID | 118203027 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol |
| SMILES | CC(C)C[C@H](O)[C@H](O)c1cn[nH]c1 |
| InChI | InChI=1S/C9H16N2O2/c1-6(2)3-8(12)9(13)7-4-10-11-5-7/h4-6,8-9,12-13H,3H2,1-2H3,(H,10,11)/t8-,9+/m0/s1 |
| InChIKey | QAZDJXHAMIPDKX-DTWKUNHWSA-N |
| XLogP | 0.85 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol?
The IUPAC name of (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol (CID 118203027) is (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol.
What is the SMILES notation for (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol?
The canonical SMILES for (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol is CC(C)C[C@H](O)[C@H](O)c1cn[nH]c1.
What is the InChIKey of (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol?
The InChIKey is QAZDJXHAMIPDKX-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H16N2O2/c1-6(2)3-8(12)9(13)7-4-10-11-5-7/h4-6,8-9,12-13H,3H2,1-2H3,(H,10,11)/t8-,9+/m0/s1.
What are the key properties of (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol?
(1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol has a molecular weight of 184.24 g/mol, XLogP of 0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-4-methyl-1-(1H-pyrazol-4-yl)pentane-1,2-diol is sourced from PubChem (CID 118203027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).