About methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate
methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate (PubChem CID 118203152) has the molecular formula C13H22O12
and a molecular weight of 370.31 g/mol. Its IUPAC name is methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate.
Molecular Properties
| Compound Name | methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate |
| PubChem CID | 118203152 |
| Molecular Formula | C13H22O12 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate |
| SMILES | COC(=O)OCOC1C(O)C(O)C(OC)C(O)C1OCOC(=O)OC |
| InChI | InChI=1S/C13H22O12/c1-19-9-6(14)7(15)10(22-4-24-12(17)20-2)11(8(9)16)23-5-25-13(18)21-3/h6-11,14-16H,4-5H2,1-3H3 |
| InChIKey | BWJXGCWBJWMZMA-UHFFFAOYSA-N |
| XLogP | -1.65 |
| TPSA | 159.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate?
The IUPAC name of methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate (CID 118203152) is methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate.
What is the SMILES notation for methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate?
The canonical SMILES for methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate is COC(=O)OCOC1C(O)C(O)C(OC)C(O)C1OCOC(=O)OC.
What is the InChIKey of methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate?
The InChIKey is BWJXGCWBJWMZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O12/c1-19-9-6(14)7(15)10(22-4-24-12(17)20-2)11(8(9)16)23-5-25-13(18)21-3/h6-11,14-16H,4-5H2,1-3H3.
What are the key properties of methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate?
methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate has a molecular weight of 370.31 g/mol, XLogP of -1.65, 7 rotatable bonds, 3 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [2,3,5-trihydroxy-4-methoxy-6-(methoxycarbonyloxymethoxy)cyclohexyl]oxymethyl carbonate is sourced from PubChem (CID 118203152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).