C13H24O8 — CID 118203169
(2,3,4,5-tetrahydroxy-6-methoxycyclohexyl)oxymethyl 2,2-dimethylpropanoate (PubChem CID 118203169) has the molecular formula C13H24O8 and a molecular weight of 308.33 g/mol. Its IUPAC name is (2,3,4,5-tetrahydroxy-6-methoxycyclohexyl)oxymethyl 2,2-dimethylpropanoate.
| Compound Name | (2,3,4,5-tetrahydroxy-6-methoxycyclohexyl)oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118203169 |
| Molecular Formula | C13H24O8 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (2,3,4,5-tetrahydroxy-6-methoxycyclohexyl)oxymethyl 2,2-dimethylpropanoate |
| SMILES | COC1C(O)C(O)C(O)C(O)C1OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H24O8/c1-13(2,3)12(18)21-5-20-11-9(17)7(15)6(14)8(16)10(11)19-4/h6-11,14-17H,5H2,1-4H3 |
| InChIKey | FOOHKHYJYSVNIU-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|