C18H23ClO3S — CID 118203350
(1S,5R,6S,9S,12R)-12-(4-chlorophenyl)sulfanyl-5,9-dimethyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane (PubChem CID 118203350) has the molecular formula C18H23ClO3S and a molecular weight of 354.90 g/mol. Its IUPAC name is (1S,5R,6S,9S,12R)-12-(4-chlorophenyl)sulfanyl-5,9-dimethyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane.
| Compound Name | (1S,5R,6S,9S,12R)-12-(4-chlorophenyl)sulfanyl-5,9-dimethyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
|---|---|
| PubChem CID | 118203350 |
| Molecular Formula | C18H23ClO3S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (1S,5R,6S,9S,12R)-12-(4-chlorophenyl)sulfanyl-5,9-dimethyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
| SMILES | C[C@@H]1CCC[C@]23OO[C@@](C)(CC[C@@H]12)O[C@@H]3Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClO3S/c1-12-4-3-10-18-15(12)9-11-17(2,21-22-18)20-16(18)23-14-7-5-13(19)6-8-14/h5-8,12,15-16H,3-4,9-11H2,1-2H3/t12-,15+,16-,17+,18+/m1/s1 |
| InChIKey | RAMPBPXRFKBZBQ-IDTSGUGQSA-N |
| XLogP | 5.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|