C11H13NOS — CID 11820348
4a,5,6,7,8,10-hexahydrothieno[3,2-b]quinolizin-4-one (PubChem CID 11820348) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 4a,5,6,7,8,10-hexahydrothieno[3,2-b]quinolizin-4-one.
| Compound Name | 4a,5,6,7,8,10-hexahydrothieno[3,2-b]quinolizin-4-one |
|---|---|
| PubChem CID | 11820348 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 4a,5,6,7,8,10-hexahydrothieno[3,2-b]quinolizin-4-one |
| SMILES | O=C1c2ccsc2CN2CCCCC12 |
| InChI | InChI=1S/C11H13NOS/c13-11-8-4-6-14-10(8)7-12-5-2-1-3-9(11)12/h4,6,9H,1-3,5,7H2 |
| InChIKey | FFGYTSQUYVDFSD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |