About (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate
(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate (PubChem CID 118203485) has the molecular formula C10H13NO2S
and a molecular weight of 211.29 g/mol. Its IUPAC name is (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate.
Molecular Properties
| Compound Name | (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate |
| PubChem CID | 118203485 |
| Molecular Formula | C10H13NO2S |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate |
| SMILES | CC(=O)Oc1cc2c(s1)CCN(C)C2 |
| InChI | InChI=1S/C10H13NO2S/c1-7(12)13-10-5-8-6-11(2)4-3-9(8)14-10/h5H,3-4,6H2,1-2H3 |
| InChIKey | MWRFKXXOINHRSD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate?
The IUPAC name of (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate (CID 118203485) is (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate.
What is the SMILES notation for (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate?
The canonical SMILES for (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate is CC(=O)Oc1cc2c(s1)CCN(C)C2.
What is the InChIKey of (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate?
The InChIKey is MWRFKXXOINHRSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S/c1-7(12)13-10-5-8-6-11(2)4-3-9(8)14-10/h5H,3-4,6H2,1-2H3.
What are the key properties of (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate?
(5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate has a molecular weight of 211.29 g/mol, XLogP of 1.66, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl) acetate is sourced from PubChem (CID 118203485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).