About 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol
2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol (PubChem CID 11820356) has the molecular formula C6H7Cl2N3O
and a molecular weight of 208.05 g/mol. Its IUPAC name is 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol |
| PubChem CID | 11820356 |
| Molecular Formula | C6H7Cl2N3O |
| Molecular Weight | 208.05 g/mol |
| Exact Mass | 207.00 |
| IUPAC Name | 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol |
| SMILES | OCCNc1cc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C6H7Cl2N3O/c7-4-3-5(9-1-2-12)11-6(8)10-4/h3,12H,1-2H2,(H,9,10,11) |
| InChIKey | FRHWAHTVIJGJRX-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.05 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol?
The IUPAC name of 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol (CID 11820356) is 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol.
What is the SMILES notation for 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol?
The canonical SMILES for 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol is OCCNc1cc(Cl)nc(Cl)n1.
What is the InChIKey of 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol?
The InChIKey is FRHWAHTVIJGJRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7Cl2N3O/c7-4-3-5(9-1-2-12)11-6(8)10-4/h3,12H,1-2H2,(H,9,10,11).
What are the key properties of 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol?
2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol has a molecular weight of 208.05 g/mol, XLogP of 1.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dichloropyrimidin-4-yl)amino]ethanol is sourced from PubChem (CID 11820356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).