About 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione
5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione (PubChem CID 11820359) has the molecular formula C9H8N2O4
and a molecular weight of 208.17 g/mol. Its IUPAC name is 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione.
Molecular Properties
| Compound Name | 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione |
| PubChem CID | 11820359 |
| Molecular Formula | C9H8N2O4 |
| Molecular Weight | 208.17 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione |
| SMILES | COc1ccc(O)c2c(=O)[nH][nH]c(=O)c12 |
| InChI | InChI=1S/C9H8N2O4/c1-15-5-3-2-4(12)6-7(5)9(14)11-10-8(6)13/h2-3,12H,1H3,(H,10,13)(H,11,14) |
| InChIKey | FXSNYUWJQYWZBN-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione?
The IUPAC name of 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione (CID 11820359) is 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione.
What is the SMILES notation for 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione?
The canonical SMILES for 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione is COc1ccc(O)c2c(=O)[nH][nH]c(=O)c12.
What is the InChIKey of 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione?
The InChIKey is FXSNYUWJQYWZBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O4/c1-15-5-3-2-4(12)6-7(5)9(14)11-10-8(6)13/h2-3,12H,1H3,(H,10,13)(H,11,14).
What are the key properties of 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione?
5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione has a molecular weight of 208.17 g/mol, XLogP of -0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-8-methoxy-2,3-dihydrophthalazine-1,4-dione is sourced from PubChem (CID 11820359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).