About (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine
(1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine (PubChem CID 118203917) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine |
| PubChem CID | 118203917 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine |
| SMILES | CC(C)=C/C(=C\N)c1ccc(N2CCNCC2)nc1 |
| InChI | InChI=1S/C15H22N4/c1-12(2)9-14(10-16)13-3-4-15(18-11-13)19-7-5-17-6-8-19/h3-4,9-11,17H,5-8,16H2,1-2H3/b14-10+ |
| InChIKey | KKQODSNIMLVXLY-GXDHUFHOSA-N |
| XLogP | 1.76 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine?
The IUPAC name of (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine (CID 118203917) is (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine.
What is the SMILES notation for (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine?
The canonical SMILES for (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine is CC(C)=C/C(=C\N)c1ccc(N2CCNCC2)nc1.
What is the InChIKey of (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine?
The InChIKey is KKQODSNIMLVXLY-GXDHUFHOSA-N. The full InChI is InChI=1S/C15H22N4/c1-12(2)9-14(10-16)13-3-4-15(18-11-13)19-7-5-17-6-8-19/h3-4,9-11,17H,5-8,16H2,1-2H3/b14-10+.
What are the key properties of (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine?
(1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine has a molecular weight of 258.37 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-4-methyl-2-(6-piperazin-1-yl-3-pyridinyl)penta-1,3-dien-1-amine is sourced from PubChem (CID 118203917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).