About [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane
[4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane (PubChem CID 118204495) has the molecular formula C16H20P2
and a molecular weight of 274.28 g/mol. Its IUPAC name is [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane.
Molecular Properties
| Compound Name | [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane |
| PubChem CID | 118204495 |
| Molecular Formula | C16H20P2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane |
| SMILES | Cc1ccc(-c2ccc(PP)c(C)c2C)cc1C |
| InChI | InChI=1S/C16H20P2/c1-10-5-6-14(9-11(10)2)15-7-8-16(18-17)13(4)12(15)3/h5-9,18H,17H2,1-4H3 |
| InChIKey | KMJPHFSAOIKXJN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane?
The IUPAC name of [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane (CID 118204495) is [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane.
What is the SMILES notation for [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane?
The canonical SMILES for [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane is Cc1ccc(-c2ccc(PP)c(C)c2C)cc1C.
What is the InChIKey of [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane?
The InChIKey is KMJPHFSAOIKXJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20P2/c1-10-5-6-14(9-11(10)2)15-7-8-16(18-17)13(4)12(15)3/h5-9,18H,17H2,1-4H3.
What are the key properties of [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane?
[4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane has a molecular weight of 274.28 g/mol, XLogP of 4.68, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(3,4-dimethylphenyl)-2,3-dimethylphenyl]-phosphanylphosphane is sourced from PubChem (CID 118204495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).