C21H13ClF3N3O4S — CID 118204690
N-[7-chloro-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 118204690) has the molecular formula C21H13ClF3N3O4S and a molecular weight of 495.87 g/mol. Its IUPAC name is N-[7-chloro-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[7-chloro-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 118204690 |
| Molecular Formula | C21H13ClF3N3O4S |
| Molecular Weight | 495.87 g/mol |
| Exact Mass | 495.03 |
| IUPAC Name | N-[7-chloro-1,3-dioxo-2-(pyridin-3-ylmethyl)isoindol-4-yl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=C1c2c(Cl)ccc(NS(=O)(=O)c3ccc(C(F)(F)F)cc3)c2C(=O)N1Cc1cccnc1 |
| InChI | InChI=1S/C21H13ClF3N3O4S/c22-15-7-8-16(27-33(31,32)14-5-3-13(4-6-14)21(23,24)25)18-17(15)19(29)28(20(18)30)11-12-2-1-9-26-10-12/h1-10,27H,11H2 |
| InChIKey | MEJFUUGDZKSZMH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.87 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|