C20H17ClFN3O — CID 118205384
4-(5-chloro-2-fluoro-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline (PubChem CID 118205384) has the molecular formula C20H17ClFN3O and a molecular weight of 369.83 g/mol. Its IUPAC name is 4-(5-chloro-2-fluoro-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline.
| Compound Name | 4-(5-chloro-2-fluoro-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 118205384 |
| Molecular Formula | C20H17ClFN3O |
| Molecular Weight | 369.83 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 4-(5-chloro-2-fluoro-3-pyridinyl)-2-(pyridin-2-ylmethoxy)-5,6,7,8-tetrahydroquinoline |
| SMILES | Fc1ncc(Cl)cc1-c1cc(OCc2ccccn2)nc2c1CCCC2 |
| InChI | InChI=1S/C20H17ClFN3O/c21-13-9-17(20(22)24-11-13)16-10-19(25-18-7-2-1-6-15(16)18)26-12-14-5-3-4-8-23-14/h3-5,8-11H,1-2,6-7,12H2 |
| InChIKey | CJLUSSTUNPTOKF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|