C20H18FN3O — CID 118205428
2-[(6-fluoro-2-pyridinyl)methoxy]-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline (PubChem CID 118205428) has the molecular formula C20H18FN3O and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[(6-fluoro-2-pyridinyl)methoxy]-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline.
| Compound Name | 2-[(6-fluoro-2-pyridinyl)methoxy]-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 118205428 |
| Molecular Formula | C20H18FN3O |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[(6-fluoro-2-pyridinyl)methoxy]-4-pyridin-3-yl-5,6,7,8-tetrahydroquinoline |
| SMILES | Fc1cccc(COc2cc(-c3cccnc3)c3c(n2)CCCC3)n1 |
| InChI | InChI=1S/C20H18FN3O/c21-19-9-3-6-15(23-19)13-25-20-11-17(14-5-4-10-22-12-14)16-7-1-2-8-18(16)24-20/h3-6,9-12H,1-2,7-8,13H2 |
| InChIKey | NWFNOWWXMDPZLB-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|