C21H21N3O5S — CID 118205758
3-oxo-1'-[1-[4-[(sulfinoamino)methyl]phenyl]cyclopropanecarbonyl]spiro[furo[3,4-c]pyridine-1,3'-pyrrolidine] (PubChem CID 118205758) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is 3-oxo-1'-[1-[4-[(sulfinoamino)methyl]phenyl]cyclopropanecarbonyl]spiro[furo[3,4-c]pyridine-1,3'-pyrrolidine].
| Compound Name | 3-oxo-1'-[1-[4-[(sulfinoamino)methyl]phenyl]cyclopropanecarbonyl]spiro[furo[3,4-c]pyridine-1,3'-pyrrolidine] |
|---|---|
| PubChem CID | 118205758 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 3-oxo-1'-[1-[4-[(sulfinoamino)methyl]phenyl]cyclopropanecarbonyl]spiro[furo[3,4-c]pyridine-1,3'-pyrrolidine] |
| SMILES | O=C1OC2(CCN(C(=O)C3(c4ccc(CNS(=O)O)cc4)CC3)C2)c2ccncc21 |
| InChI | InChI=1S/C21H21N3O5S/c25-18-16-12-22-9-5-17(16)21(29-18)8-10-24(13-21)19(26)20(6-7-20)15-3-1-14(2-4-15)11-23-30(27)28/h1-5,9,12,23H,6-8,10-11,13H2,(H,27,28) |
| InChIKey | XEULSLLUXSMHMO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|