C22H25N7O4S — CID 118206725
6-(5-cyanopyrrolo[2,3-b]pyridin-1-yl)-N-[2-(methanesulfonamido)ethyl]-4-(oxan-4-ylamino)pyridine-3-carboxamide (PubChem CID 118206725) has the molecular formula C22H25N7O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is 6-(5-cyanopyrrolo[2,3-b]pyridin-1-yl)-N-[2-(methanesulfonamido)ethyl]-4-(oxan-4-ylamino)pyridine-3-carboxamide.
| Compound Name | 6-(5-cyanopyrrolo[2,3-b]pyridin-1-yl)-N-[2-(methanesulfonamido)ethyl]-4-(oxan-4-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118206725 |
| Molecular Formula | C22H25N7O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 6-(5-cyanopyrrolo[2,3-b]pyridin-1-yl)-N-[2-(methanesulfonamido)ethyl]-4-(oxan-4-ylamino)pyridine-3-carboxamide |
| SMILES | CS(=O)(=O)NCCNC(=O)c1cnc(-n2ccc3cc(C#N)cnc32)cc1NC1CCOCC1 |
| InChI | InChI=1S/C22H25N7O4S/c1-34(31,32)27-6-5-24-22(30)18-14-25-20(11-19(18)28-17-3-8-33-9-4-17)29-7-2-16-10-15(12-23)13-26-21(16)29/h2,7,10-11,13-14,17,27H,3-6,8-9H2,1H3,(H,24,30)(H,25,28) |
| InChIKey | DVUSWHVFVDTUEL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|