C27H26F7NO6S — CID 118207854
4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid (PubChem CID 118207854) has the molecular formula C27H26F7NO6S and a molecular weight of 625.56 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 118207854 |
| Molecular Formula | C27H26F7NO6S |
| Molecular Weight | 625.56 g/mol |
| Exact Mass | 625.14 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pyrrolidine-1-carbonyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N2CC[C@](c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H26F7NO6S/c28-20-9-11-21(12-10-20)42(40,41)24(13-14-35(15-24)22(36)16-1-3-17(4-2-16)23(37)38)18-5-7-19(8-6-18)25(39,26(29,30)31)27(32,33)34/h5-12,16-17,39H,1-4,13-15H2,(H,37,38)/t16?,17?,24-/m0/s1 |
| InChIKey | JROYPKLSTOFQSI-DFSZNTFHSA-N |
| XLogP | 4.93 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |