C27H27F8NO7S2 — CID 118207904
[4-(1,2-dihydroxyethyl)-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone (PubChem CID 118207904) has the molecular formula C27H27F8NO7S2 and a molecular weight of 693.63 g/mol. Its IUPAC name is [4-(1,2-dihydroxyethyl)-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone.
| Compound Name | [4-(1,2-dihydroxyethyl)-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 118207904 |
| Molecular Formula | C27H27F8NO7S2 |
| Molecular Weight | 693.63 g/mol |
| Exact Mass | 693.11 |
| IUPAC Name | [4-(1,2-dihydroxyethyl)-1,1-dioxothian-4-yl]-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1)C1(C(O)CO)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C27H27F8NO7S2/c28-19-5-7-20(8-6-19)45(42,43)24(17-1-3-18(4-2-17)25(29,26(30,31)32)27(33,34)35)9-12-36(16-24)22(39)23(21(38)15-37)10-13-44(40,41)14-11-23/h1-8,21,37-38H,9-16H2/t21?,24-/m0/s1 |
| InChIKey | YQKRMDKGRBAFLF-FHZUCYEKSA-N |
| XLogP | 3.56 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.63 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |