C28H25F8NO5S — CID 118207907
4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 118207907) has the molecular formula C28H25F8NO5S and a molecular weight of 639.56 g/mol. Its IUPAC name is 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 118207907 |
| Molecular Formula | C28H25F8NO5S |
| Molecular Weight | 639.56 g/mol |
| Exact Mass | 639.13 |
| IUPAC Name | 4-[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]bicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | O=C(O)C12CCC(C(=O)N3CC[C@](c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4)(S(=O)(=O)c4ccc(F)cc4)C3)(CC1)C2 |
| InChI | InChI=1S/C28H25F8NO5S/c29-19-5-7-20(8-6-19)43(41,42)25(17-1-3-18(4-2-17)26(30,27(31,32)33)28(34,35)36)13-14-37(16-25)21(38)23-9-11-24(15-23,12-10-23)22(39)40/h1-8H,9-16H2,(H,39,40)/t23?,24?,25-/m0/s1 |
| InChIKey | XHTMLUDJBICVHB-STEQJIOHSA-N |
| XLogP | 6.05 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.56 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |