C27H27F8N3O4S — CID 118207945
1-[4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperazin-1-yl]ethanone (PubChem CID 118207945) has the molecular formula C27H27F8N3O4S and a molecular weight of 641.58 g/mol. Its IUPAC name is 1-[4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 118207945 |
| Molecular Formula | C27H27F8N3O4S |
| Molecular Weight | 641.58 g/mol |
| Exact Mass | 641.16 |
| IUPAC Name | 1-[4-[(3R)-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine-1-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)c(C)c3)C2)CC1 |
| InChI | InChI=1S/C27H27F8N3O4S/c1-17-15-21(7-8-22(17)28)43(41,42)24(9-10-38(16-24)23(40)37-13-11-36(12-14-37)18(2)39)19-3-5-20(6-4-19)25(29,26(30,31)32)27(33,34)35/h3-8,15H,9-14,16H2,1-2H3/t24-/m0/s1 |
| InChIKey | HXNZXZJWLAHFPD-DEOSSOPVSA-N |
| XLogP | 5.08 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |