C26H25F8NO6S2 — CID 118207954
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(hydroxymethyl)-1,1-dioxothian-4-yl]methanone (PubChem CID 118207954) has the molecular formula C26H25F8NO6S2 and a molecular weight of 663.61 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(hydroxymethyl)-1,1-dioxothian-4-yl]methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(hydroxymethyl)-1,1-dioxothian-4-yl]methanone |
|---|---|
| PubChem CID | 118207954 |
| Molecular Formula | C26H25F8NO6S2 |
| Molecular Weight | 663.61 g/mol |
| Exact Mass | 663.10 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-[4-(hydroxymethyl)-1,1-dioxothian-4-yl]methanone |
| SMILES | O=C(N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1)C1(CO)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C26H25F8NO6S2/c27-19-5-7-20(8-6-19)43(40,41)23(17-1-3-18(4-2-17)24(28,25(29,30)31)26(32,33)34)9-12-35(15-23)21(37)22(16-36)10-13-42(38,39)14-11-22/h1-8,36H,9-16H2/t23-/m0/s1 |
| InChIKey | FGMWBGPEMWZHPH-QHCPKHFHSA-N |
| XLogP | 4.20 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |