C27H27F8NO5S2 — CID 118207966
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methylsulfonylcyclohexyl)methanone (PubChem CID 118207966) has the molecular formula C27H27F8NO5S2 and a molecular weight of 661.63 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methylsulfonylcyclohexyl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methylsulfonylcyclohexyl)methanone |
|---|---|
| PubChem CID | 118207966 |
| Molecular Formula | C27H27F8NO5S2 |
| Molecular Weight | 661.63 g/mol |
| Exact Mass | 661.12 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-methylsulfonylcyclohexyl)methanone |
| SMILES | CS(=O)(=O)C1CCC(C(=O)N2CC[C@](c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)(S(=O)(=O)c3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C27H27F8NO5S2/c1-42(38,39)21-10-2-17(3-11-21)23(37)36-15-14-24(16-36,43(40,41)22-12-8-20(28)9-13-22)18-4-6-19(7-5-18)25(29,26(30,31)32)27(33,34)35/h4-9,12-13,17,21H,2-3,10-11,14-16H2,1H3/t17?,21?,24-/m0/s1 |
| InChIKey | ROJWRLPLLGYYCX-PZYUZEHPSA-N |
| XLogP | 5.62 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.63 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |