C26H20F9NO3S — CID 118207981
3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine (PubChem CID 118207981) has the molecular formula C26H20F9NO3S and a molecular weight of 597.50 g/mol. Its IUPAC name is 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 118207981 |
| Molecular Formula | C26H20F9NO3S |
| Molecular Weight | 597.50 g/mol |
| Exact Mass | 597.10 |
| IUPAC Name | 3-[4-[2-[(2,6-difluorophenyl)methoxy]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]-3-(4-fluorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1(c2ccc(C(OCc3c(F)cccc3F)(C(F)(F)F)C(F)(F)F)cc2)CCNC1 |
| InChI | InChI=1S/C26H20F9NO3S/c27-18-8-10-19(11-9-18)40(37,38)23(12-13-36-15-23)16-4-6-17(7-5-16)24(25(30,31)32,26(33,34)35)39-14-20-21(28)2-1-3-22(20)29/h1-11,36H,12-15H2 |
| InChIKey | MEHSHYGABGFKAG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.50 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |