C26H25F8NO4S — CID 118207991
[(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxycyclohexyl)methanone (PubChem CID 118207991) has the molecular formula C26H25F8NO4S and a molecular weight of 599.54 g/mol. Its IUPAC name is [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxycyclohexyl)methanone.
| Compound Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxycyclohexyl)methanone |
|---|---|
| PubChem CID | 118207991 |
| Molecular Formula | C26H25F8NO4S |
| Molecular Weight | 599.54 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | [(3R)-3-(4-fluorophenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidin-1-yl]-(4-hydroxycyclohexyl)methanone |
| SMILES | O=C(C1CCC(O)CC1)N1CC[C@](c2ccc(C(F)(C(F)(F)F)C(F)(F)F)cc2)(S(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C26H25F8NO4S/c27-19-7-11-21(12-8-19)40(38,39)23(13-14-35(15-23)22(37)16-1-9-20(36)10-2-16)17-3-5-18(6-4-17)24(28,25(29,30)31)26(32,33)34/h3-8,11-12,16,20,36H,1-2,9-10,13-15H2/t16?,20?,23-/m0/s1 |
| InChIKey | QNLMLIHRGZGZRQ-JCJCGPQSSA-N |
| XLogP | 5.57 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.54 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |