C27H23F8NO2S — CID 118207998
(3R)-1-benzyl-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine (PubChem CID 118207998) has the molecular formula C27H23F8NO2S and a molecular weight of 577.54 g/mol. Its IUPAC name is (3R)-1-benzyl-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine.
| Compound Name | (3R)-1-benzyl-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
|---|---|
| PubChem CID | 118207998 |
| Molecular Formula | C27H23F8NO2S |
| Molecular Weight | 577.54 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | (3R)-1-benzyl-3-(4-fluoro-3-methylphenyl)sulfonyl-3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]pyrrolidine |
| SMILES | Cc1cc(S(=O)(=O)[C@@]2(c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3)CCN(Cc3ccccc3)C2)ccc1F |
| InChI | InChI=1S/C27H23F8NO2S/c1-18-15-22(11-12-23(18)28)39(37,38)24(13-14-36(17-24)16-19-5-3-2-4-6-19)20-7-9-21(10-8-20)25(29,26(30,31)32)27(33,34)35/h2-12,15H,13-14,16-17H2,1H3/t24-/m0/s1 |
| InChIKey | LMPXSNXRGUFDCH-DEOSSOPVSA-N |
| XLogP | 7.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.54 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |